C11H15Cl2NO6 — CID 139082573
2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;methanol;morpholin-4-ium (PubChem CID 139082573) has the molecular formula C11H15Cl2NO6 and a molecular weight of 328.15 g/mol. Its IUPAC name is 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;methanol;morpholin-4-ium.
| Compound Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;methanol;morpholin-4-ium |
|---|---|
| PubChem CID | 139082573 |
| Molecular Formula | C11H15Cl2NO6 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;methanol;morpholin-4-ium |
| SMILES | C1COCC[NH2+]1.CO.O=C1C(O)=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/C6H2Cl2O4.C4H9NO.CH4O/c7-1-3(9)5(11)2(8)6(12)4(1)10;1-3-6-4-2-5-1;1-2/h9,12H;5H,1-4H2;2H,1H3 |
| InChIKey | JOYPTSBWLNFPIN-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|