C26H24 — CID 139082581
(1S,10R,13S,22R)-heptacyclo[20.2.1.110,13.02,21.03,8.09,14.015,20]hexacosa-2(21),3,5,7,9(14),15,17,19-octaene (PubChem CID 139082581) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is (1S,10R,13S,22R)-heptacyclo[20.2.1.110,13.02,21.03,8.09,14.015,20]hexacosa-2(21),3,5,7,9(14),15,17,19-octaene.
| Compound Name | (1S,10R,13S,22R)-heptacyclo[20.2.1.110,13.02,21.03,8.09,14.015,20]hexacosa-2(21),3,5,7,9(14),15,17,19-octaene |
|---|---|
| PubChem CID | 139082581 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1S,10R,13S,22R)-heptacyclo[20.2.1.110,13.02,21.03,8.09,14.015,20]hexacosa-2(21),3,5,7,9(14),15,17,19-octaene |
| SMILES | c1ccc2c(c1)C1=C(c3ccccc3C3=C2[C@H]2CC[C@@H]3C2)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C26H24/c1-2-6-20-19(5-1)23-15-9-10-17(13-15)25(23)21-7-3-4-8-22(21)26-18-12-11-16(14-18)24(20)26/h1-8,15-18H,9-14H2/b23-19-,24-20-,25-21-,26-22-/t15-,16+,17+,18- |
| InChIKey | UGMVJZLTNJFRBG-ICTYYSPESA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|