C40H44B2N2O4 — CID 139082734
9-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]carbazole (PubChem CID 139082734) has the molecular formula C40H44B2N2O4 and a molecular weight of 638.43 g/mol. Its IUPAC name is 9-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]carbazole.
| Compound Name | 9-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]carbazole |
|---|---|
| PubChem CID | 139082734 |
| Molecular Formula | C40H44B2N2O4 |
| Molecular Weight | 638.43 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | 9-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]carbazole |
| SMILES | CC1(C)OB(/C=C/n2c3ccccc3c3ccccc32)OC1(C)C.CC1(C)OB(/C=C/n2c3ccccc3c3ccccc32)OC1(C)C |
| InChI | InChI=1S/2C20H22BNO2/c2*1-19(2)20(3,4)24-21(23-19)13-14-22-17-11-7-5-9-15(17)16-10-6-8-12-18(16)22/h2*5-14H,1-4H3/b2*14-13+ |
| InChIKey | AWSHRZNXJFIPHQ-IGRBIYNPSA-N |
| XLogP | 9.79 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.43 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|