C34H36N4O8 — CID 139083037
N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-hydroxy-3-methylbenzamide (PubChem CID 139083037) has the molecular formula C34H36N4O8 and a molecular weight of 628.68 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-hydroxy-3-methylbenzamide.
| Compound Name | N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 139083037 |
| Molecular Formula | C34H36N4O8 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-hydroxy-3-methylbenzamide |
| SMILES | CCOc1cccc(/C=N/NC(=O)c2cccc(C)c2O)c1O.CCOc1cccc(/C=N/NC(=O)c2cccc(C)c2O)c1O |
| InChI | InChI=1S/2C17H18N2O4/c2*1-3-23-14-9-5-7-12(16(14)21)10-18-19-17(22)13-8-4-6-11(2)15(13)20/h2*4-10,20-21H,3H2,1-2H3,(H,19,22)/b2*18-10+ |
| InChIKey | MZZYOBWYCWUSMM-IGJPJNRDSA-N |
| XLogP | 5.14 |
| TPSA | 182.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|