About (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone
(3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone (PubChem CID 139083076) has the molecular formula C42H40O6
and a molecular weight of 640.78 g/mol. Its IUPAC name is (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone |
| PubChem CID | 139083076 |
| Molecular Formula | C42H40O6 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone |
| SMILES | CCc1cc(C(=O)c2ccccc2)c2cc(OC)c(OC)cc2c1.CCc1cc(C(=O)c2ccccc2)c2cc(OC)c(OC)cc2c1 |
| InChI | InChI=1S/2C21H20O3/c2*1-4-14-10-16-12-19(23-2)20(24-3)13-17(16)18(11-14)21(22)15-8-6-5-7-9-15/h2*5-13H,4H2,1-3H3 |
| InChIKey | BSDNALGSBCBPFW-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone?
The IUPAC name of (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone (CID 139083076) is (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone.
What is the SMILES notation for (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone?
The canonical SMILES for (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone is CCc1cc(C(=O)c2ccccc2)c2cc(OC)c(OC)cc2c1.CCc1cc(C(=O)c2ccccc2)c2cc(OC)c(OC)cc2c1.
What is the InChIKey of (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone?
The InChIKey is BSDNALGSBCBPFW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H20O3/c2*1-4-14-10-16-12-19(23-2)20(24-3)13-17(16)18(11-14)21(22)15-8-6-5-7-9-15/h2*5-13H,4H2,1-3H3.
What are the key properties of (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone?
(3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone has a molecular weight of 640.78 g/mol, XLogP of 9.30, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-6,7-dimethoxynaphthalen-1-yl)-phenylmethanone is sourced from PubChem (CID 139083076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).