C14H15N3O5 — CID 139083211
2-[(E)-C-methyl-N-(2-nitroanilino)carbonimidoyl]benzene-1,3-diol;hydrate (PubChem CID 139083211) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-[(E)-C-methyl-N-(2-nitroanilino)carbonimidoyl]benzene-1,3-diol;hydrate.
| Compound Name | 2-[(E)-C-methyl-N-(2-nitroanilino)carbonimidoyl]benzene-1,3-diol;hydrate |
|---|---|
| PubChem CID | 139083211 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[(E)-C-methyl-N-(2-nitroanilino)carbonimidoyl]benzene-1,3-diol;hydrate |
| SMILES | C/C(=N\Nc1ccccc1[N+](=O)[O-])c1c(O)cccc1O.O |
| InChI | InChI=1S/C14H13N3O4.H2O/c1-9(14-12(18)7-4-8-13(14)19)15-16-10-5-2-3-6-11(10)17(20)21;/h2-8,16,18-19H,1H3;1H2/b15-9+; |
| InChIKey | UYQJDXPSJCVAIX-NSPIFIKESA-N |
| XLogP | 2.02 |
| TPSA | 139.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|