C24H29NO8 — CID 139083245
(2R,3R)-2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;triethylazanium (PubChem CID 139083245) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is (2R,3R)-2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;triethylazanium.
| Compound Name | (2R,3R)-2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;triethylazanium |
|---|---|
| PubChem CID | 139083245 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (2R,3R)-2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C(O[C@@H](C(=O)[O-])[C@@H](OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C6H15N/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12;1-4-7(5-2)6-3/h1-10,13-14H,(H,19,20)(H,21,22);4-6H2,1-3H3/t13-,14-;/m1./s1 |
| InChIKey | FOCUNUZZYSKUFX-DTPOWOMPSA-N |
| XLogP | 0.20 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |