About 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine
4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine (PubChem CID 139083310) has the molecular formula C25H20N2O5
and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine |
| PubChem CID | 139083310 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine |
| SMILES | O=C(O)c1ccc(C(O)c2ccc(C(=O)O)cc2)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C15H12O5.C10H8N2/c16-13(9-1-5-11(6-2-9)14(17)18)10-3-7-12(8-4-10)15(19)20;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8,13,16H,(H,17,18)(H,19,20);1-8H |
| InChIKey | RTFMFGXHOIKAGU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine?
The IUPAC name of 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine (CID 139083310) is 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine.
What is the SMILES notation for 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine?
The canonical SMILES for 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine is O=C(O)c1ccc(C(O)c2ccc(C(=O)O)cc2)cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine?
The InChIKey is RTFMFGXHOIKAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5.C10H8N2/c16-13(9-1-5-11(6-2-9)14(17)18)10-3-7-12(8-4-10)15(19)20;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8,13,16H,(H,17,18)(H,19,20);1-8H.
What are the key properties of 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine?
4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine has a molecular weight of 428.44 g/mol, XLogP of 4.31, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-carboxyphenyl)-hydroxymethyl]benzoic acid;4-pyridin-4-ylpyridine is sourced from PubChem (CID 139083310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).