About N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol
N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 139083375) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
Molecular Properties
| Compound Name | N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| PubChem CID | 139083375 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | C/C=[N+](\[O-])CC.Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H14O2.C4H9NO/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-3-5(6)4-2/h1-12,21-22H;3H,4H2,1-2H3/b;5-3- |
| InChIKey | QGADBBIIQMHDRL-PJAIOPLOSA-N |
| XLogP | 5.68 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The IUPAC name of N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (CID 139083375) is N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
What is the SMILES notation for N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The canonical SMILES for N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol is C/C=[N+](\[O-])CC.Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12.
What is the InChIKey of N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The InChIKey is QGADBBIIQMHDRL-PJAIOPLOSA-N. The full InChI is InChI=1S/C20H14O2.C4H9NO/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-3-5(6)4-2/h1-12,21-22H;3H,4H2,1-2H3/b;5-3-.
What are the key properties of N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol has a molecular weight of 373.45 g/mol, XLogP of 5.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanimine oxide;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol is sourced from PubChem (CID 139083375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).