C20H12N2O4Pd — CID 139083449
acridine;palladium(2+);pyridine-2,6-dicarboxylate (PubChem CID 139083449) has the molecular formula C20H12N2O4Pd and a molecular weight of 450.75 g/mol. Its IUPAC name is acridine;palladium(2+);pyridine-2,6-dicarboxylate.
| Compound Name | acridine;palladium(2+);pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 139083449 |
| Molecular Formula | C20H12N2O4Pd |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | acridine;palladium(2+);pyridine-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])n1.[Pd+2].c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C7H5NO4.Pd/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;9-6(10)4-2-1-3-5(8-4)7(11)12;/h1-9H;1-3H,(H,9,10)(H,11,12);/q;;+2/p-2 |
| InChIKey | IMLNPILGGXYNNP-UHFFFAOYSA-L |
| XLogP | 1.19 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|