C30H40O12S2 — CID 139083493
[(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139083493) has the molecular formula C30H40O12S2 and a molecular weight of 656.77 g/mol. Its IUPAC name is [(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139083493 |
| Molecular Formula | C30H40O12S2 |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | [(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@@H]3OC(C)(C)O[C@@H]3O2)cc1.Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@@H]3OC(C)(C)O[C@@H]3O2)cc1 |
| InChI | InChI=1S/2C15H20O6S/c2*1-10-4-6-12(7-5-10)22(16,17)18-9-11-8-13-14(19-11)21-15(2,3)20-13/h2*4-7,11,13-14H,8-9H2,1-3H3/t2*11-,13-,14-/m00/s1 |
| InChIKey | QLOZGQLIRBSKNT-OTUDWQTJSA-N |
| XLogP | 3.93 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|