C54H54N6 — CID 139083580
2,4,6-tris(2,4-dimethylphenyl)-1,3,5-triazine (PubChem CID 139083580) has the molecular formula C54H54N6 and a molecular weight of 787.07 g/mol. Its IUPAC name is 2,4,6-tris(2,4-dimethylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(2,4-dimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 139083580 |
| Molecular Formula | C54H54N6 |
| Molecular Weight | 787.07 g/mol |
| Exact Mass | 786.44 |
| IUPAC Name | 2,4,6-tris(2,4-dimethylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(C)c1.Cc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/2C27H27N3/c2*1-16-7-10-22(19(4)13-16)25-28-26(23-11-8-17(2)14-20(23)5)30-27(29-25)24-12-9-18(3)15-21(24)6/h2*7-15H,1-6H3 |
| InChIKey | NBQDRQJCLRMAEG-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.07 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |