C26H27ClN2O — CID 139083995
(E,2S,3R,6R)-N-[(2-chlorophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine (PubChem CID 139083995) has the molecular formula C26H27ClN2O and a molecular weight of 418.97 g/mol. Its IUPAC name is (E,2S,3R,6R)-N-[(2-chlorophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine.
| Compound Name | (E,2S,3R,6R)-N-[(2-chlorophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine |
|---|---|
| PubChem CID | 139083995 |
| Molecular Formula | C26H27ClN2O |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E,2S,3R,6R)-N-[(2-chlorophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine |
| SMILES | C[C@H]1/C(=N/OCc2ccccc2Cl)C[C@H](c2ccccc2)N(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H27ClN2O/c1-19-24(28-30-18-22-15-9-10-16-23(22)27)17-25(20-11-5-3-6-12-20)29(2)26(19)21-13-7-4-8-14-21/h3-16,19,25-26H,17-18H2,1-2H3/b28-24+/t19-,25+,26-/m0/s1 |
| InChIKey | IHYVQJRAGJCQFG-LKGNKYOESA-N |
| XLogP | 6.67 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|