About [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol
[2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol (PubChem CID 139084106) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol.
Molecular Properties
| Compound Name | [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol |
| PubChem CID | 139084106 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol |
| SMILES | CC(C)(C)C1OCC(CO)(CO)CO1 |
| InChI | InChI=1S/C10H20O4/c1-9(2,3)8-13-6-10(4-11,5-12)7-14-8/h8,11-12H,4-7H2,1-3H3 |
| InChIKey | AODZQTQPSLSWSL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
The IUPAC name of [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol (CID 139084106) is [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol.
What is the SMILES notation for [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
The canonical SMILES for [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol is CC(C)(C)C1OCC(CO)(CO)CO1.
What is the InChIKey of [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
The InChIKey is AODZQTQPSLSWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-9(2,3)8-13-6-10(4-11,5-12)7-14-8/h8,11-12H,4-7H2,1-3H3.
What are the key properties of [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
[2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol has a molecular weight of 204.27 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-tert-butyl-5-(hydroxymethyl)-1,3-dioxan-5-yl]methanol is sourced from PubChem (CID 139084106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).