C31H40NO2P — CID 139084386
(1R)-N-[(S)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-phenylmethyl]-1-phenylethanamine (PubChem CID 139084386) has the molecular formula C31H40NO2P and a molecular weight of 489.64 g/mol. Its IUPAC name is (1R)-N-[(S)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-phenylmethyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[(S)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-phenylmethyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 139084386 |
| Molecular Formula | C31H40NO2P |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (1R)-N-[(S)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-phenylmethyl]-1-phenylethanamine |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[P@@](=O)(c1ccccc1)[C@H](N[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40NO2P/c1-23(2)29-21-20-24(3)22-30(29)34-35(33,28-18-12-7-13-19-28)31(27-16-10-6-11-17-27)32-25(4)26-14-8-5-9-15-26/h5-19,23-25,29-32H,20-22H2,1-4H3/t24-,25-,29+,30-,31+,35+/m1/s1 |
| InChIKey | PRUZPORJHVUJKL-KLDHMRDTSA-N |
| XLogP | 8.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|