C42H48N10O — CID 139084433
bis(3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene);hydrate (PubChem CID 139084433) has the molecular formula C42H48N10O and a molecular weight of 708.92 g/mol. Its IUPAC name is bis(3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene);hydrate.
| Compound Name | bis(3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene);hydrate |
|---|---|
| PubChem CID | 139084433 |
| Molecular Formula | C42H48N10O |
| Molecular Weight | 708.92 g/mol |
| Exact Mass | 708.40 |
| IUPAC Name | bis(3-[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene);hydrate |
| SMILES | C[C@H]1CCN(Cc2ccccc2)C[C@H]1n1cnc2cnc3[nH]ccc3c21.C[C@H]1CCN(Cc2ccccc2)C[C@H]1n1cnc2cnc3[nH]ccc3c21.O |
| InChI | InChI=1S/2C21H23N5.H2O/c2*1-15-8-10-25(12-16-5-3-2-4-6-16)13-19(15)26-14-24-18-11-23-21-17(20(18)26)7-9-22-21;/h2*2-7,9,11,14-15,19H,8,10,12-13H2,1H3,(H,22,23);1H2/t2*15-,19+;/m00./s1 |
| InChIKey | CLHZZZTYDUVYGC-POPDLMGSSA-N |
| XLogP | 7.17 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.92 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |