About [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone
[2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone (PubChem CID 139084962) has the molecular formula C32H30F2O4
and a molecular weight of 516.58 g/mol. Its IUPAC name is [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone |
| PubChem CID | 139084962 |
| Molecular Formula | C32H30F2O4 |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CCCCOc1ccc2ccc(OCCCC)c(C(=O)c3ccc(F)cc3)c2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H30F2O4/c1-3-5-19-37-26-17-11-21-12-18-27(38-20-6-4-2)30(32(36)23-9-15-25(34)16-10-23)28(21)29(26)31(35)22-7-13-24(33)14-8-22/h7-18H,3-6,19-20H2,1-2H3 |
| InChIKey | OHYNPOOZUYUPIL-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone?
The IUPAC name of [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone (CID 139084962) is [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone?
The canonical SMILES for [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone is CCCCOc1ccc2ccc(OCCCC)c(C(=O)c3ccc(F)cc3)c2c1C(=O)c1ccc(F)cc1.
What is the InChIKey of [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone?
The InChIKey is OHYNPOOZUYUPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H30F2O4/c1-3-5-19-37-26-17-11-21-12-18-27(38-20-6-4-2)30(32(36)23-9-15-25(34)16-10-23)28(21)29(26)31(35)22-7-13-24(33)14-8-22/h7-18H,3-6,19-20H2,1-2H3.
What are the key properties of [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone?
[2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone has a molecular weight of 516.58 g/mol, XLogP of 7.94, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,7-dibutoxy-8-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 139084962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).