About bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid
bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid (PubChem CID 139084964) has the molecular formula C32H26N4O4
and a molecular weight of 530.58 g/mol. Its IUPAC name is bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid.
Molecular Properties
| Compound Name | bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid |
| PubChem CID | 139084964 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid |
| SMILES | C(=C/c1ccccn1)\c1ccncc1.C(=C/c1ccccn1)\c1ccncc1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/2C12H10N2.C8H6O4/c2*1-2-8-14-12(3-1)5-4-11-6-9-13-10-7-11;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*1-10H;1-4H,(H,9,10)(H,11,12)/b2*5-4+; |
| InChIKey | FKGDHTWCNQBFRE-WDTNTSJCSA-N |
| XLogP | 6.38 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid?
The IUPAC name of bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid (CID 139084964) is bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid.
What is the SMILES notation for bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid?
The canonical SMILES for bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid is C(=C/c1ccccn1)\c1ccncc1.C(=C/c1ccccn1)\c1ccncc1.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid?
The InChIKey is FKGDHTWCNQBFRE-WDTNTSJCSA-N. The full InChI is InChI=1S/2C12H10N2.C8H6O4/c2*1-2-8-14-12(3-1)5-4-11-6-9-13-10-7-11;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*1-10H;1-4H,(H,9,10)(H,11,12)/b2*5-4+;.
What are the key properties of bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid?
bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid has a molecular weight of 530.58 g/mol, XLogP of 6.38, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(E)-2-pyridin-4-ylethenyl]pyridine);terephthalic acid is sourced from PubChem (CID 139084964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).