About palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine)
palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) (PubChem CID 139084966) has the molecular formula C22H18N4Pd
and a molecular weight of 444.83 g/mol. Its IUPAC name is palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine).
Molecular Properties
| Compound Name | palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) |
| PubChem CID | 139084966 |
| Molecular Formula | C22H18N4Pd |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) |
| SMILES | C(=N/c1ccccc1)\c1ccc[n-]1.C(=N/c1ccccc1)\c1ccc[n-]1.[Pd+2] |
| InChI | InChI=1S/2C11H9N2.Pd/c2*1-2-5-10(6-3-1)13-9-11-7-4-8-12-11;/h2*1-9H;/q2*-1;+2/b2*13-9+; |
| InChIKey | ICWZKUUQDDDLIC-YJCYQSLBSA-N |
| XLogP | 4.79 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine)?
The IUPAC name of palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) (CID 139084966) is palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine).
What is the SMILES notation for palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine)?
The canonical SMILES for palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) is C(=N/c1ccccc1)\c1ccc[n-]1.C(=N/c1ccccc1)\c1ccc[n-]1.[Pd+2].
What is the InChIKey of palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine)?
The InChIKey is ICWZKUUQDDDLIC-YJCYQSLBSA-N. The full InChI is InChI=1S/2C11H9N2.Pd/c2*1-2-5-10(6-3-1)13-9-11-7-4-8-12-11;/h2*1-9H;/q2*-1;+2/b2*13-9+;.
What are the key properties of palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine)?
palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) has a molecular weight of 444.83 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);bis(N-phenyl-1-pyrrol-1-id-2-ylmethanimine) is sourced from PubChem (CID 139084966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).