C21H20FN3O5 — CID 139085117
methyl (3R,3'S,4'R)-4'-(4-fluorophenyl)-1'-methyl-3'-(nitromethyl)-2-oxospiro[1H-indole-3,2'-pyrrolidine]-3'-carboxylate (PubChem CID 139085117) has the molecular formula C21H20FN3O5 and a molecular weight of 413.41 g/mol. Its IUPAC name is methyl (3R,3'S,4'R)-4'-(4-fluorophenyl)-1'-methyl-3'-(nitromethyl)-2-oxospiro[1H-indole-3,2'-pyrrolidine]-3'-carboxylate.
| Compound Name | methyl (3R,3'S,4'R)-4'-(4-fluorophenyl)-1'-methyl-3'-(nitromethyl)-2-oxospiro[1H-indole-3,2'-pyrrolidine]-3'-carboxylate |
|---|---|
| PubChem CID | 139085117 |
| Molecular Formula | C21H20FN3O5 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | methyl (3R,3'S,4'R)-4'-(4-fluorophenyl)-1'-methyl-3'-(nitromethyl)-2-oxospiro[1H-indole-3,2'-pyrrolidine]-3'-carboxylate |
| SMILES | COC(=O)[C@]1(C[N+](=O)[O-])[C@@H](c2ccc(F)cc2)CN(C)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H20FN3O5/c1-24-11-16(13-7-9-14(22)10-8-13)20(12-25(28)29,19(27)30-2)21(24)15-5-3-4-6-17(15)23-18(21)26/h3-10,16H,11-12H2,1-2H3,(H,23,26)/t16-,20+,21+/m1/s1 |
| InChIKey | WZWNZSHUHLPBAR-CZAAIQMYSA-N |
| XLogP | 2.14 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|