C16H15F3N2O4 — CID 139085136
methyl (1R,3S,3aR,6aS)-5-methyl-4,6-dioxo-1-[2-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 139085136) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-5-methyl-4,6-dioxo-1-[2-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-5-methyl-4,6-dioxo-1-[2-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 139085136 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-5-methyl-4,6-dioxo-1-[2-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C16H15F3N2O4/c1-21-13(22)9-10(14(21)23)12(15(24)25-2)20-11(9)7-5-3-4-6-8(7)16(17,18)19/h3-6,9-12,20H,1-2H3/t9-,10+,11-,12-/m0/s1 |
| InChIKey | SQXSNVJOCAPQHL-USZNOCQGSA-N |
| XLogP | 1.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|