C19H30O3Si — CID 139085275
(4aS,5S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,5,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 139085275) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (4aS,5S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,5,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,5S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,5,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139085275 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (4aS,5S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,5,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | CC1=CC(=O)[C@H]2[C@@H](C)C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C1=O |
| InChI | InChI=1S/C19H30O3Si/c1-12-9-10-15(22-23(7,8)18(3,4)5)19(6)16(12)14(20)11-13(2)17(19)21/h9-12,15-16H,1-8H3/t12-,15+,16+,19+/m0/s1 |
| InChIKey | YONUPHDWJUOAPQ-GCUGWZBJSA-N |
| XLogP | 4.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|