C16H13Cl2N3O2S — CID 139085284
(E,3S)-3-chloro-N-[(E)-(4-chlorophenyl)methylideneamino]-1-methyl-2,2-dioxo-2λ6,1-benzothiazin-4-imine (PubChem CID 139085284) has the molecular formula C16H13Cl2N3O2S and a molecular weight of 382.27 g/mol. Its IUPAC name is (E,3S)-3-chloro-N-[(E)-(4-chlorophenyl)methylideneamino]-1-methyl-2,2-dioxo-2λ6,1-benzothiazin-4-imine.
| Compound Name | (E,3S)-3-chloro-N-[(E)-(4-chlorophenyl)methylideneamino]-1-methyl-2,2-dioxo-2λ6,1-benzothiazin-4-imine |
|---|---|
| PubChem CID | 139085284 |
| Molecular Formula | C16H13Cl2N3O2S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | (E,3S)-3-chloro-N-[(E)-(4-chlorophenyl)methylideneamino]-1-methyl-2,2-dioxo-2λ6,1-benzothiazin-4-imine |
| SMILES | CN1c2ccccc2/C(=N/N=C/c2ccc(Cl)cc2)[C@H](Cl)S1(=O)=O |
| InChI | InChI=1S/C16H13Cl2N3O2S/c1-21-14-5-3-2-4-13(14)15(16(18)24(21,22)23)20-19-10-11-6-8-12(17)9-7-11/h2-10,16H,1H3/b19-10+,20-15-/t16-/m1/s1 |
| InChIKey | QZRHBQJWIBGSJI-VSIZLWEMSA-N |
| XLogP | 3.51 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|