About 2-azaniumylethylazanium;chloride;isothiocyanate
2-azaniumylethylazanium;chloride;isothiocyanate (PubChem CID 139085470) has the molecular formula C3H10ClN3S
and a molecular weight of 155.65 g/mol. Its IUPAC name is 2-azaniumylethylazanium;chloride;isothiocyanate.
Molecular Properties
| Compound Name | 2-azaniumylethylazanium;chloride;isothiocyanate |
| PubChem CID | 139085470 |
| Molecular Formula | C3H10ClN3S |
| Molecular Weight | 155.65 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 2-azaniumylethylazanium;chloride;isothiocyanate |
| SMILES | [Cl-].[N-]=C=S.[NH3+]CC[NH3+] |
| InChI | InChI=1S/C2H8N2.CNS.ClH/c3-1-2-4;2-1-3;/h1-4H2;;1H/q;-1;/p+1 |
| InChIKey | LTWIKQIWBLVRSC-UHFFFAOYSA-O |
| XLogP | -4.87 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.65 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-azaniumylethylazanium;chloride;isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethylazanium;chloride;isothiocyanate?
The IUPAC name of 2-azaniumylethylazanium;chloride;isothiocyanate (CID 139085470) is 2-azaniumylethylazanium;chloride;isothiocyanate.
What is the SMILES notation for 2-azaniumylethylazanium;chloride;isothiocyanate?
The canonical SMILES for 2-azaniumylethylazanium;chloride;isothiocyanate is [Cl-].[N-]=C=S.[NH3+]CC[NH3+].
What is the InChIKey of 2-azaniumylethylazanium;chloride;isothiocyanate?
The InChIKey is LTWIKQIWBLVRSC-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H8N2.CNS.ClH/c3-1-2-4;2-1-3;/h1-4H2;;1H/q;-1;/p+1.
What are the key properties of 2-azaniumylethylazanium;chloride;isothiocyanate?
2-azaniumylethylazanium;chloride;isothiocyanate has a molecular weight of 155.65 g/mol, XLogP of -4.87, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethylazanium;chloride;isothiocyanate is sourced from PubChem (CID 139085470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).