About copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate)
copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) (PubChem CID 139085772) has the molecular formula C26H20CuN6O2
and a molecular weight of 512.03 g/mol. Its IUPAC name is copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate).
Molecular Properties
| Compound Name | copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) |
| PubChem CID | 139085772 |
| Molecular Formula | C26H20CuN6O2 |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) |
| SMILES | [Cu+2].[O-]/C(=N\N=C\c1ccncc1)c1ccccc1.[O-]/C(=N\N=C\c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/2C13H11N3O.Cu/c2*17-13(12-4-2-1-3-5-12)16-15-10-11-6-8-14-9-7-11;/h2*1-10H,(H,16,17);/q;;+2/p-2/b2*15-10+; |
| InChIKey | JBSWDDCAWYTSTI-ZQSWXEMLSA-L |
| XLogP | 2.44 |
| TPSA | 121.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate)?
The IUPAC name of copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) (CID 139085772) is copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate).
What is the SMILES notation for copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate)?
The canonical SMILES for copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) is [Cu+2].[O-]/C(=N\N=C\c1ccncc1)c1ccccc1.[O-]/C(=N\N=C\c1ccncc1)c1ccccc1.
What is the InChIKey of copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate)?
The InChIKey is JBSWDDCAWYTSTI-ZQSWXEMLSA-L. The full InChI is InChI=1S/2C13H11N3O.Cu/c2*17-13(12-4-2-1-3-5-12)16-15-10-11-6-8-14-9-7-11;/h2*1-10H,(H,16,17);/q;;+2/p-2/b2*15-10+;.
What are the key properties of copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate)?
copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) has a molecular weight of 512.03 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis((NZ,Z)-N-(pyridin-4-ylmethylidene)benzenecarbohydrazonate) is sourced from PubChem (CID 139085772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).