C26H24BF2N3O — CID 139085811
2-[[4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]iminomethyl]phenol (PubChem CID 139085811) has the molecular formula C26H24BF2N3O and a molecular weight of 443.31 g/mol. Its IUPAC name is 2-[[4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139085811 |
| Molecular Formula | C26H24BF2N3O |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-[[4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]iminomethyl]phenol |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(/N=C/c3ccccc3O)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C26H24BF2N3O/c1-16-13-18(3)31-25(16)24(26-17(2)14-19(4)32(26)27(31,28)29)20-9-11-22(12-10-20)30-15-21-7-5-6-8-23(21)33/h5-15,33H,1-4H3/b30-15+ |
| InChIKey | HFFKRNQQTJGKFK-FJEPWZHXSA-N |
| XLogP | 5.99 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|