C16H28O — CID 139085820
(1R,3S,8R,10R,11R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodecan-11-ol (PubChem CID 139085820) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (1R,3S,8R,10R,11R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodecan-11-ol.
| Compound Name | (1R,3S,8R,10R,11R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodecan-11-ol |
|---|---|
| PubChem CID | 139085820 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (1R,3S,8R,10R,11R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodecan-11-ol |
| SMILES | C[C@@H]1C[C@@H]2C(C)(C)CCC[C@@]3(C)C[C@@]23C[C@H]1O |
| InChI | InChI=1S/C16H28O/c1-11-8-13-14(2,3)6-5-7-15(4)10-16(13,15)9-12(11)17/h11-13,17H,5-10H2,1-4H3/t11-,12-,13-,15+,16+/m1/s1 |
| InChIKey | TUBSLEYEAHUIMJ-UVQHHTHUSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |