C19H10ClNO4 — CID 139085823
2-chloro-3-[(2-oxochromen-6-yl)amino]naphthalene-1,4-dione (PubChem CID 139085823) has the molecular formula C19H10ClNO4 and a molecular weight of 351.75 g/mol. Its IUPAC name is 2-chloro-3-[(2-oxochromen-6-yl)amino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[(2-oxochromen-6-yl)amino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139085823 |
| Molecular Formula | C19H10ClNO4 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-chloro-3-[(2-oxochromen-6-yl)amino]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Nc2ccc3oc(=O)ccc3c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H10ClNO4/c20-16-17(19(24)13-4-2-1-3-12(13)18(16)23)21-11-6-7-14-10(9-11)5-8-15(22)25-14/h1-9,21H |
| InChIKey | ZBJKHYCRYFXCHQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|