C46H42Cl2N8 — CID 139085834
5-(4-chlorophenyl)-7-(4-methylphenyl)-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidine (PubChem CID 139085834) has the molecular formula C46H42Cl2N8 and a molecular weight of 777.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-7-(4-methylphenyl)-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 5-(4-chlorophenyl)-7-(4-methylphenyl)-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 139085834 |
| Molecular Formula | C46H42Cl2N8 |
| Molecular Weight | 777.80 g/mol |
| Exact Mass | 776.29 |
| IUPAC Name | 5-(4-chlorophenyl)-7-(4-methylphenyl)-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1ccc(-n2cc(-c3ccc(Cl)cc3)c3c(N4CCCC4)ncnc32)cc1.Cc1ccc(-n2cc(-c3ccc(Cl)cc3)c3c(N4CCCC4)ncnc32)cc1 |
| InChI | InChI=1S/2C23H21ClN4/c2*1-16-4-10-19(11-5-16)28-14-20(17-6-8-18(24)9-7-17)21-22(25-15-26-23(21)28)27-12-2-3-13-27/h2*4-11,14-15H,2-3,12-13H2,1H3 |
| InChIKey | GAGYUBMHGXOQQK-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.80 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |