About N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate
N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate (PubChem CID 139085939) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate.
Molecular Properties
| Compound Name | N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate |
| PubChem CID | 139085939 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate |
| SMILES | CC(C)(C)C(=O)Nc1cccc(N)[nH+]1.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C10H15N3O.C7H6O2/c1-10(2,3)9(14)13-8-6-4-5-7(11)12-8;8-7(9)6-4-2-1-3-5-6/h4-6H,1-3H3,(H3,11,12,13,14);1-5H,(H,8,9) |
| InChIKey | OFELMMLBXDFEQP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate?
The IUPAC name of N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate (CID 139085939) is N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate.
What is the SMILES notation for N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate?
The canonical SMILES for N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate is CC(C)(C)C(=O)Nc1cccc(N)[nH+]1.O=C([O-])c1ccccc1.
What is the InChIKey of N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate?
The InChIKey is OFELMMLBXDFEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O.C7H6O2/c1-10(2,3)9(14)13-8-6-4-5-7(11)12-8;8-7(9)6-4-2-1-3-5-6/h4-6H,1-3H3,(H3,11,12,13,14);1-5H,(H,8,9).
What are the key properties of N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate?
N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate has a molecular weight of 315.37 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-aminopyridin-1-ium-2-yl)-2,2-dimethylpropanamide benzoate is sourced from PubChem (CID 139085939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).