C20H16O7 — CID 139086096
[(3R,3aR,6S,6aS)-6-benzoyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate (PubChem CID 139086096) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-6-benzoyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate.
| Compound Name | [(3R,3aR,6S,6aS)-6-benzoyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate |
|---|---|
| PubChem CID | 139086096 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(3R,3aR,6S,6aS)-6-benzoyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1C(=O)O[C@H]2[C@@H]1OC[C@H]2OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16O7/c21-18(12-7-3-1-4-8-12)25-14-11-24-16-15(14)26-20(23)17(16)27-19(22)13-9-5-2-6-10-13/h1-10,14-17H,11H2/t14-,15-,16+,17+/m1/s1 |
| InChIKey | IIIPGEHOXSIBSG-NCOADZHNSA-N |
| XLogP | 1.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|