C20H25NO2 — CID 139086380
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] quinoline-2-carboxylate (PubChem CID 139086380) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] quinoline-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 139086380 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] quinoline-2-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H25NO2/c1-13(2)16-10-8-14(3)12-19(16)23-20(22)18-11-9-15-6-4-5-7-17(15)21-18/h4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3/t14-,16+,19-/m1/s1 |
| InChIKey | YTZZBJLSWBGWHM-SIXWZSSISA-N |
| XLogP | 4.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |