C16H24O — CID 139086399
(1R,3S,8R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodec-9-en-11-one (PubChem CID 139086399) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1R,3S,8R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodec-9-en-11-one.
| Compound Name | (1R,3S,8R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodec-9-en-11-one |
|---|---|
| PubChem CID | 139086399 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1R,3S,8R)-3,7,7,10-tetramethyltricyclo[6.4.0.01,3]dodec-9-en-11-one |
| SMILES | CC1=C[C@@H]2C(C)(C)CCC[C@@]3(C)C[C@@]23CC1=O |
| InChI | InChI=1S/C16H24O/c1-11-8-13-14(2,3)6-5-7-15(4)10-16(13,15)9-12(11)17/h8,13H,5-7,9-10H2,1-4H3/t13-,15+,16+/m1/s1 |
| InChIKey | JEUIDCRGLYEWGK-KBMXLJTQSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |