C17H13F2NO2 — CID 139086407
(E)-1-(1-benzofuran-2-yl)-N-[(2,6-difluorophenyl)methoxy]ethanimine (PubChem CID 139086407) has the molecular formula C17H13F2NO2 and a molecular weight of 301.29 g/mol. Its IUPAC name is (E)-1-(1-benzofuran-2-yl)-N-[(2,6-difluorophenyl)methoxy]ethanimine.
| Compound Name | (E)-1-(1-benzofuran-2-yl)-N-[(2,6-difluorophenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 139086407 |
| Molecular Formula | C17H13F2NO2 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (E)-1-(1-benzofuran-2-yl)-N-[(2,6-difluorophenyl)methoxy]ethanimine |
| SMILES | C/C(=N\OCc1c(F)cccc1F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H13F2NO2/c1-11(17-9-12-5-2-3-8-16(12)22-17)20-21-10-13-14(18)6-4-7-15(13)19/h2-9H,10H2,1H3/b20-11+ |
| InChIKey | NTNYRKJVUYZPKC-RGVLZGJSSA-N |
| XLogP | 4.65 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|