About 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran
3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran (PubChem CID 139086545) has the molecular formula C17H15FO3S
and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran |
| PubChem CID | 139086545 |
| Molecular Formula | C17H15FO3S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran |
| SMILES | Cc1cc(C)c2oc(C)c(S(=O)(=O)c3ccccc3F)c2c1 |
| InChI | InChI=1S/C17H15FO3S/c1-10-8-11(2)16-13(9-10)17(12(3)21-16)22(19,20)15-7-5-4-6-14(15)18/h4-9H,1-3H3 |
| InChIKey | QRCDECGRHQMZOX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran?
The IUPAC name of 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran (CID 139086545) is 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran.
What is the SMILES notation for 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran?
The canonical SMILES for 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran is Cc1cc(C)c2oc(C)c(S(=O)(=O)c3ccccc3F)c2c1.
What is the InChIKey of 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran?
The InChIKey is QRCDECGRHQMZOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FO3S/c1-10-8-11(2)16-13(9-10)17(12(3)21-16)22(19,20)15-7-5-4-6-14(15)18/h4-9H,1-3H3.
What are the key properties of 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran?
3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran has a molecular weight of 318.37 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)sulfonyl-2,5,7-trimethyl-1-benzofuran is sourced from PubChem (CID 139086545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).