C40H76Si — CID 139086613
tetrakis[(E)-2,3,5,5-tetramethylhex-2-enyl]silane (PubChem CID 139086613) has the molecular formula C40H76Si and a molecular weight of 585.13 g/mol. Its IUPAC name is tetrakis[(E)-2,3,5,5-tetramethylhex-2-enyl]silane.
| Compound Name | tetrakis[(E)-2,3,5,5-tetramethylhex-2-enyl]silane |
|---|---|
| PubChem CID | 139086613 |
| Molecular Formula | C40H76Si |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.57 |
| IUPAC Name | tetrakis[(E)-2,3,5,5-tetramethylhex-2-enyl]silane |
| SMILES | C/C(CC(C)(C)C)=C(/C)C[Si](C/C(C)=C(\C)CC(C)(C)C)(C/C(C)=C(\C)CC(C)(C)C)C/C(C)=C(\C)CC(C)(C)C |
| InChI | InChI=1S/C40H76Si/c1-29(21-37(9,10)11)33(5)25-41(26-34(6)30(2)22-38(12,13)14,27-35(7)31(3)23-39(15,16)17)28-36(8)32(4)24-40(18,19)20/h21-28H2,1-20H3/b33-29+,34-30+,35-31+,36-32+ |
| InChIKey | ZPRNOFHKUMLQHD-MCTOCYMBSA-N |
| XLogP | 14.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|