C28H33N2PS2 — CID 139086651
octyl N-[(E)-(2-diphenylphosphanylphenyl)methylideneamino]carbamodithioate (PubChem CID 139086651) has the molecular formula C28H33N2PS2 and a molecular weight of 492.69 g/mol. Its IUPAC name is octyl N-[(E)-(2-diphenylphosphanylphenyl)methylideneamino]carbamodithioate.
| Compound Name | octyl N-[(E)-(2-diphenylphosphanylphenyl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 139086651 |
| Molecular Formula | C28H33N2PS2 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | octyl N-[(E)-(2-diphenylphosphanylphenyl)methylideneamino]carbamodithioate |
| SMILES | CCCCCCCCSC(=S)N/N=C/c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33N2PS2/c1-2-3-4-5-6-15-22-33-28(32)30-29-23-24-16-13-14-21-27(24)31(25-17-9-7-10-18-25)26-19-11-8-12-20-26/h7-14,16-21,23H,2-6,15,22H2,1H3,(H,30,32)/b29-23+ |
| InChIKey | IJQZPIQUGMWFNN-BYNJWEBRSA-N |
| XLogP | 6.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|