C30H28N4S2 — CID 139086672
2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole (PubChem CID 139086672) has the molecular formula C30H28N4S2 and a molecular weight of 508.72 g/mol. Its IUPAC name is 2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 139086672 |
| Molecular Formula | C30H28N4S2 |
| Molecular Weight | 508.72 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole |
| SMILES | c1ccc(-c2cn3c4c(sc3n2)CCCC4)cc1.c1ccc(-c2cn3c4c(sc3n2)CCCC4)cc1 |
| InChI | InChI=1S/2C15H14N2S/c2*1-2-6-11(7-3-1)12-10-17-13-8-4-5-9-14(13)18-15(17)16-12/h2*1-3,6-7,10H,4-5,8-9H2 |
| InChIKey | NDRQGUUZUSBJPC-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.72 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |