C18H12F4N2S2 — CID 139086718
N-[[2,3,5,6-tetrafluoro-4-[(thiophen-2-ylmethylideneamino)methyl]phenyl]methyl]-1-thiophen-2-ylmethanimine (PubChem CID 139086718) has the molecular formula C18H12F4N2S2 and a molecular weight of 396.43 g/mol. Its IUPAC name is N-[[2,3,5,6-tetrafluoro-4-[(thiophen-2-ylmethylideneamino)methyl]phenyl]methyl]-1-thiophen-2-ylmethanimine.
| Compound Name | N-[[2,3,5,6-tetrafluoro-4-[(thiophen-2-ylmethylideneamino)methyl]phenyl]methyl]-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 139086718 |
| Molecular Formula | C18H12F4N2S2 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[[2,3,5,6-tetrafluoro-4-[(thiophen-2-ylmethylideneamino)methyl]phenyl]methyl]-1-thiophen-2-ylmethanimine |
| SMILES | Fc1c(F)c(C/N=C/c2cccs2)c(F)c(F)c1C/N=C/c1cccs1 |
| InChI | InChI=1S/C18H12F4N2S2/c19-15-13(9-23-7-11-3-1-5-25-11)16(20)18(22)14(17(15)21)10-24-8-12-4-2-6-26-12/h1-8H,9-10H2/b23-7+,24-8+ |
| InChIKey | AUJUYECEKOEJQB-ZPNKGADNSA-N |
| XLogP | 5.60 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|