About 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione
1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione (PubChem CID 139086892) has the molecular formula C7H8N4S
and a molecular weight of 180.24 g/mol. Its IUPAC name is 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione.
Molecular Properties
| Compound Name | 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| PubChem CID | 139086892 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| SMILES | CCn1ncc2c(=S)nc[nH]c21 |
| InChI | InChI=1S/C7H8N4S/c1-2-11-6-5(3-10-11)7(12)9-4-8-6/h3-4H,2H2,1H3,(H,8,9,12) |
| InChIKey | GYHMTBFZFWHDQN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione?
The IUPAC name of 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione (CID 139086892) is 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione.
What is the SMILES notation for 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione?
The canonical SMILES for 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione is CCn1ncc2c(=S)nc[nH]c21.
What is the InChIKey of 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione?
The InChIKey is GYHMTBFZFWHDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S/c1-2-11-6-5(3-10-11)7(12)9-4-8-6/h3-4H,2H2,1H3,(H,8,9,12).
What are the key properties of 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione?
1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione has a molecular weight of 180.24 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione is sourced from PubChem (CID 139086892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).