C30H40Br2N2O4 — CID 139086962
ethyl (2S)-2-(4-bromoanilino)-3,4-dimethylpent-3-enoate (PubChem CID 139086962) has the molecular formula C30H40Br2N2O4 and a molecular weight of 652.47 g/mol. Its IUPAC name is ethyl (2S)-2-(4-bromoanilino)-3,4-dimethylpent-3-enoate.
| Compound Name | ethyl (2S)-2-(4-bromoanilino)-3,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 139086962 |
| Molecular Formula | C30H40Br2N2O4 |
| Molecular Weight | 652.47 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | ethyl (2S)-2-(4-bromoanilino)-3,4-dimethylpent-3-enoate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(Br)cc1)C(C)=C(C)C.CCOC(=O)[C@@H](Nc1ccc(Br)cc1)C(C)=C(C)C |
| InChI | InChI=1S/2C15H20BrNO2/c2*1-5-19-15(18)14(11(4)10(2)3)17-13-8-6-12(16)7-9-13/h2*6-9,14,17H,5H2,1-4H3/t2*14-/m00/s1 |
| InChIKey | HMGZSKCAPCJPGK-DXZWIFNPSA-N |
| XLogP | 8.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.47 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|