C28H18N2O10 — CID 139087087
(1,3-dioxobenzo[de]isoquinolin-2-yl) methyl carbonate (PubChem CID 139087087) has the molecular formula C28H18N2O10 and a molecular weight of 542.46 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) methyl carbonate.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) methyl carbonate |
|---|---|
| PubChem CID | 139087087 |
| Molecular Formula | C28H18N2O10 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) methyl carbonate |
| SMILES | COC(=O)ON1C(=O)c2cccc3cccc(c23)C1=O.COC(=O)ON1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/2C14H9NO5/c2*1-19-14(18)20-15-12(16)9-6-2-4-8-5-3-7-10(11(8)9)13(15)17/h2*2-7H,1H3 |
| InChIKey | ZECYTZKNCAFEKZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|