C20H42O3S2Si — CID 139087138
(2R,3S,4R,5R)-5-(1,3-dithian-2-yl)-3-methyl-1-tri(propan-2-yl)silyloxyhexane-2,4-diol (PubChem CID 139087138) has the molecular formula C20H42O3S2Si and a molecular weight of 422.77 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(1,3-dithian-2-yl)-3-methyl-1-tri(propan-2-yl)silyloxyhexane-2,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(1,3-dithian-2-yl)-3-methyl-1-tri(propan-2-yl)silyloxyhexane-2,4-diol |
|---|---|
| PubChem CID | 139087138 |
| Molecular Formula | C20H42O3S2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (2R,3S,4R,5R)-5-(1,3-dithian-2-yl)-3-methyl-1-tri(propan-2-yl)silyloxyhexane-2,4-diol |
| SMILES | CC(C)[Si](OC[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)C1SCCCS1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H42O3S2Si/c1-13(2)26(14(3)4,15(5)6)23-12-18(21)16(7)19(22)17(8)20-24-10-9-11-25-20/h13-22H,9-12H2,1-8H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | AAUVXCVCDGBRKQ-AKHDSKFASA-N |
| XLogP | 5.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|