C56H52N8O12 — CID 139087202
ethyl acetate;bis(methyl 2-ethoxy-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate) (PubChem CID 139087202) has the molecular formula C56H52N8O12 and a molecular weight of 1029.08 g/mol. Its IUPAC name is ethyl acetate;bis(methyl 2-ethoxy-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate).
| Compound Name | ethyl acetate;bis(methyl 2-ethoxy-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate) |
|---|---|
| PubChem CID | 139087202 |
| Molecular Formula | C56H52N8O12 |
| Molecular Weight | 1029.08 g/mol |
| Exact Mass | 1028.37 |
| IUPAC Name | ethyl acetate;bis(methyl 2-ethoxy-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate) |
| SMILES | CCOC(C)=O.CCOc1nc2cccc(C(=O)OC)c2n1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1.CCOc1nc2cccc(C(=O)OC)c2n1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/2C26H22N4O5.C4H8O2/c2*1-3-34-25-27-21-10-6-9-20(24(31)33-2)22(21)30(25)15-16-11-13-17(14-12-16)18-7-4-5-8-19(18)23-28-26(32)35-29-23;1-3-6-4(2)5/h2*4-14H,3,15H2,1-2H3,(H,28,29,32);3H2,1-2H3 |
| InChIKey | QRVPWPPXVJECSD-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 250.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.08 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|