About 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate
1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate (PubChem CID 139087298) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate.
Molecular Properties
| Compound Name | 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate |
| PubChem CID | 139087298 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate |
| SMILES | CCNC(=S)N/N=C(\C)c1ccccc1O.O |
| InChI | InChI=1S/C11H15N3OS.H2O/c1-3-12-11(16)14-13-8(2)9-6-4-5-7-10(9)15;/h4-7,15H,3H2,1-2H3,(H2,12,14,16);1H2/b13-8+; |
| InChIKey | KGUOEPCDJSTPAS-FNXZNAJJSA-N |
| XLogP | 0.78 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate?
The IUPAC name of 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate (CID 139087298) is 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate.
What is the SMILES notation for 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate?
The canonical SMILES for 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate is CCNC(=S)N/N=C(\C)c1ccccc1O.O.
What is the InChIKey of 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate?
The InChIKey is KGUOEPCDJSTPAS-FNXZNAJJSA-N. The full InChI is InChI=1S/C11H15N3OS.H2O/c1-3-12-11(16)14-13-8(2)9-6-4-5-7-10(9)15;/h4-7,15H,3H2,1-2H3,(H2,12,14,16);1H2/b13-8+;.
What are the key properties of 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate?
1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate has a molecular weight of 255.34 g/mol, XLogP of 0.78, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]thiourea;hydrate is sourced from PubChem (CID 139087298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).