About 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile
4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 139087376) has the molecular formula C13H4BrF4N
and a molecular weight of 330.08 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile |
| PubChem CID | 139087376 |
| Molecular Formula | C13H4BrF4N |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(-c2ccc(Br)cc2)c(F)c1F |
| InChI | InChI=1S/C13H4BrF4N/c14-7-3-1-6(2-4-7)9-12(17)10(15)8(5-19)11(16)13(9)18/h1-4H |
| InChIKey | FKMJBKJRGUOIKE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile?
The IUPAC name of 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile (CID 139087376) is 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile.
What is the SMILES notation for 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile?
The canonical SMILES for 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile is N#Cc1c(F)c(F)c(-c2ccc(Br)cc2)c(F)c1F.
What is the InChIKey of 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile?
The InChIKey is FKMJBKJRGUOIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H4BrF4N/c14-7-3-1-6(2-4-7)9-12(17)10(15)8(5-19)11(16)13(9)18/h1-4H.
What are the key properties of 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile?
4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile has a molecular weight of 330.08 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2,3,5,6-tetrafluorobenzonitrile is sourced from PubChem (CID 139087376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).