C25H31BF2N2O — CID 139087621
2,6-ditert-butyl-4-(2,2-difluoro-4,12-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol (PubChem CID 139087621) has the molecular formula C25H31BF2N2O and a molecular weight of 424.34 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,2-difluoro-4,12-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2,2-difluoro-4,12-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol |
|---|---|
| PubChem CID | 139087621 |
| Molecular Formula | C25H31BF2N2O |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,2-difluoro-4,12-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol |
| SMILES | CC1=[N+]2C(=C(c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c3ccc(C)n3[B-]2(F)F)C=C1 |
| InChI | InChI=1S/C25H31BF2N2O/c1-15-9-11-20-22(21-12-10-16(2)30(21)26(27,28)29(15)20)17-13-18(24(3,4)5)23(31)19(14-17)25(6,7)8/h9-14,31H,1-8H3 |
| InChIKey | KIJUESWLWKNFIR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 28.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|