C26H28F6N2O4 — CID 139087671
(4-hydroxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 139087671) has the molecular formula C26H28F6N2O4 and a molecular weight of 546.51 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 139087671 |
| Molecular Formula | C26H28F6N2O4 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC(O)CC1.O=C(c1ccc(C(F)(F)F)cc1)N1CCC(O)CC1 |
| InChI | InChI=1S/2C13H14F3NO2/c2*14-13(15,16)10-3-1-9(2-4-10)12(19)17-7-5-11(18)6-8-17/h2*1-4,11,18H,5-8H2 |
| InChIKey | SSAWSEIMRUADSZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |