About 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine
2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine (PubChem CID 139087682) has the molecular formula C20H18N2O4
and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine |
| PubChem CID | 139087682 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine |
| SMILES | O=C(O)Cc1ccc(CC(=O)O)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C10H10O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;11-9(12)5-7-1-2-8(4-3-7)6-10(13)14/h1-8H;1-4H,5-6H2,(H,11,12)(H,13,14) |
| InChIKey | DHLXEBDICLMKLI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine?
The IUPAC name of 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine (CID 139087682) is 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine.
What is the SMILES notation for 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine?
The canonical SMILES for 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine is O=C(O)Cc1ccc(CC(=O)O)cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine?
The InChIKey is DHLXEBDICLMKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C10H10O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;11-9(12)5-7-1-2-8(4-3-7)6-10(13)14/h1-8H;1-4H,5-6H2,(H,11,12)(H,13,14).
What are the key properties of 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine?
2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine has a molecular weight of 350.37 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(carboxymethyl)phenyl]acetic acid;4-pyridin-4-ylpyridine is sourced from PubChem (CID 139087682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).