About bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine
bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine (PubChem CID 139087696) has the molecular formula C28H28N2O6
and a molecular weight of 488.54 g/mol. Its IUPAC name is bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine |
| PubChem CID | 139087696 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine |
| SMILES | CCOc1ccc(C(=O)O)cc1.CCOc1ccc(C(=O)O)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C9H10O3/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*1-2-12-8-5-3-7(4-6-8)9(10)11/h1-8H;2*3-6H,2H2,1H3,(H,10,11) |
| InChIKey | DHTIMTLNIAHTKE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine?
The IUPAC name of bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine (CID 139087696) is bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine.
What is the SMILES notation for bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine?
The canonical SMILES for bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine is CCOc1ccc(C(=O)O)cc1.CCOc1ccc(C(=O)O)cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine?
The InChIKey is DHTIMTLNIAHTKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C9H10O3/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*1-2-12-8-5-3-7(4-6-8)9(10)11/h1-8H;2*3-6H,2H2,1H3,(H,10,11).
What are the key properties of bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine?
bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine has a molecular weight of 488.54 g/mol, XLogP of 5.71, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ethoxybenzoic acid);4-pyridin-4-ylpyridine is sourced from PubChem (CID 139087696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).